2 products were found matching "204322-23-6"!
No results were found for the filter!
FMOC-L-1,2,3,4-TETRAHYDRONORHARMAN-3-CAR
Item number: TGM-T8673-1mL
Description: FMOC-L-1,2,3,4-TETRAHYDRO NORHARMAN-3-CAR (Fmoc-Tpi-OH) is a derivative of THN. Target: Others, Antibacterial. Smiles: OC(=O)[C@@H]1Cc2c(CN1C(=O)OCC1c3ccccc3-c3ccccc13)[nH]c1ccccc21
| Keywords: | Fmoc-Tpi-OH |
| CAS | 204322-23-6 |
| MW: | 438.47 D |
From 30.00€
*
Fmoc-L-1,2,3,4-Tetrahydronorharman-3- carboxylic acid
Item number: CSB-DT3058.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 204322-23-6 |
| MW: | 438.483 D |
Please request pricing for this article.
