4 products were found matching "1775-97-9"!
No results were found for the filter!
Flavokawain B
Item number: LKT-F4503.5
A minor component of kava extract.
| Application: | Metabolic studies |
| CAS | 1775-97-9 |
| MW: | 284,31 D |
From 388.00€
*
Flavokawain B
Item number: Cay19652-1
Flavokawain B is a natural chalcone first isolated from extracts of kava roots. It induces apoptosis in androgen receptor-negative, hormone-refractory prostate cancer cell lines (IC50s = 32, 48, 6.2, and 3.9 µM for LAPC4, LNCaP, PC-3, and DU145 cells, respectively, treated for 48 hours), with increased expression of...
| Keywords: | (2E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl-2-propen-1-one |
| Application: | Apoptosis inducer, Bim expression inducer |
| CAS | 1775-97-9 |
| MW: | 284.3 D |
From 52.00€
*
Flavokawain B
Item number: TGM-T6S0735-100mg
Description: 1. Flavokawain B (Flavokavain B) has potent anti-inflammatory activity, can significantly inhibit production of NO and PGE2 in LPS-induced RAW 264.7 cells. 2. Flavokawain B, the hepatotoxic constituent from kava root, induces GSH-sensitive oxidative stress through modulation of IKK/NF-kappaB and MAPK...
| Keywords: | Flavokawin B, 2'-Hydroxy-4',6'-Dimethoxychalcone, Flavokavain B |
| Application: | Apoptosis inducer, Bim expression inducer |
| CAS | 1775-97-9 |
| MW: | 284.31 D |
From 64.00€
*
Flavokawain B (CRM)
Item number: Cay41058-100
A certified reference material categorized as a kava chalcone, intended for analytical forensic applications. Formulation: A 100 µg/ml solution in acetonitrile. InChI: InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+. InChIKey: QKQLSQLKXBHUSO-CMDGGOBGSA-N. SMILES:...
| Keywords: | Flavokavain B, (2E)-N-[4-[[3-1-(2-hydroxy-,wbr/>4,6-dimethoxy,wbr/>phenyl)-3-phenyl-2-propen-1-one |
| Application: | Certified reference material, kava chalcone |
| CAS | 1775-97-9 |
| MW: | 284.31 D |
177.00€
*
