Description: Fmoc-8-amino-3,6-dioxaoctanoic acid (Fmoc-NH-PEG2-CH2COOH) is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs) and a PEG-based PROTAC linker for the synthesis of PROTACs. Target: ADC Linker, PROTAC Linker. Smiles: OC(=O)COCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12. References:...

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...