Description: Hexapeptide-11 is a novel proteostasis network modulator in human diploid fibroblasts. Smiles: C([C@@H](NC([C@@H](NC([C@H](CC1=CC=CC=C1)N)=O)[C@@H](C)C)=O)C)(=O)N2[C@H](C(N[C@H](C(=O)N3[C@H](C(O)=O)CCC3)CC4=CC=CC=C4)=O)CCC2. References: Sklirou AD, Ralli M, Dominguez M, Papassideri I, Skaltsounis AL,...

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...