4 products were found matching "154589-96-5"!
No results were found for the filter!
Stauprimide
Item number: TGM-T16941-1mg
Description: Stauprimide is a non-broad spectrum inhibitor that binds to the MYC transcription factor NME2 and blocks its nuclear localization in ESCs, which causes down-regulation of MYC transcription. Target: Others. Smiles: COC1C(CC2OC1(C)n1c3ccccc3c3c4C(=O)NC(=O)c4c4c5ccccc5n2c4c13)N(C)C(=O)c1ccccc1. References:...
| Application: | NME2 nuclear localization inhibitor |
| CAS | 154589-96-5 |
| MW: | 584.62 D |
From 287.00€
*
Stauprimide (N-Benzoyl-7-oxostaurosporine)
Item number: S7972-56A.1
Stauprimide, a cell-permeable analog of Staurosporine, increases the efficiency of directed differentiation of mouse and human embryonic stem cells (ESCs). Stauprimide binds to NME2 and inhibits its nuclear localization, thus leading to downregulation of c-Myc. Solubility: Soluble in DMSO at 100mg/ml, very poorly...
| CAS | 154589-96-5 |
| MW: | 584.62 |
286.00€
*
Stauprimide
Item number: Cay15398-1
Stauprimide is a small molecule that increases the efficiency of mouse and human embryonic stem cell differentiation in conjunction with lineage specification cues (EC50 = 0.3 µM). It specifically inhibits the nuclear localization of NME2, which results in the suppression of c-Myc, a key regulator of...
| Keywords: | N-Benzoyl-7-oxo Staurosporine,... |
| Application: | NME2 nuclear localization inhibitor |
| CAS | 154589-96-5 |
| MW: | 584.6 D |
From 69.00€
*
Stauprimide
Item number: LKT-S761025.1
| Keywords: | Spd, ESC EMT Inducer, N-Benzoyl-7-oxo-Staurosporine, N-Benzoyl-7-oxostaurosporine |
| Application: | NME2 nuclear localization inhibitor |
| CAS | 154589-96-5 |
| MW: | 584.63 D |
From 270.00€
*
