2 products were found matching "1539314-06-1"!
No results were found for the filter!
GSK-2881078
Item number: TGM-T3618-100mg
Description: GSK-2881078 is a selective androgen receptor modulator (SARM) that is being evaluated for effects on muscle growth and strength in subjects with muscle wasting to improve their physical function. Target: Androgen Receptor. Smiles: C[C@H](CS(C)(=O)=O)n1ccc2c(c(ccc12)C#N)C(F)(F)F. References: GSK-2881078
| Keywords: | GSK2881078, GSK 2881078 |
| Application: | Selective androgen receptor modulator, SARM |
| CAS | 1539314-06-1 |
| MW: | 330.33 D |
From 40.00€
*
GSK2881078
Item number: Cay20313-5
GSK2881078 is a selective androgen receptor modulator (SARM). It induces AR-mediated transcriptional activation in PC3(AR)2 cells (EC50 = 3.99 nM), an effect that can be inhibited by the non-steroidal AR antagonist bicalutamide (Cay-14250).Formal Name:...
| Keywords: | 1-[(1R)-1-methyl-2-(methylsulfonyl)ethyl]-4-(trifluoromethyl)-1H-indole-5-carbonitrile |
| Application: | Selective androgen receptor modulator, SARM |
| CAS | 1539314-06-1 |
| MW: | 330.3 D |
From 53.00€
*
