Description: GC7 Sulfate is a potent inhibitor of deoxyhypusine synthase (DHS). Eukaryotic translation initiation factor 5A2 (eIF5A2) is the only known substrate for DHS, so GC7 inhibits the activation of eIF5A2 by inhibiting DHS activity. Target: Autophagy. Smiles: O=S(=O)(O)O.N=C(N)NCCCCCCCN. References: Shi XP,...

GC7 is an inhibitor of deoxyhypusine synthase (Ki = 9.7 nM), an enzyme that participates in the biosynthesis of the amino acid hypusine, which is formed post-translationally on eukaryotic initiation factor 5A (eIF5A). It inhibits the production of hypusine in CHO cells when used at a concentration of 1 µM. GC7 (20...