3 products were found matching "143491-57-0"!
No results were found for the filter!
Emtricitabine
Item number: Cay16879-25
Emtricitabine is a nucleoside analog and an inhibitor of HIV-1 and hepatitis B reverse transcriptase with antiviral activity. It inhibits replication of HIV-1 (EC50s = 10-20 nM) and hepatitis B (EC50s = 10-40 nM) in various cell lines. Emtricitabine inhibits duck hepatitis B viral DNA synthesis when administered...
| Keywords: | BW 1592, BW 524W91, FTC, 4-amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone |
| Application: | Reverse transcriptase inhibitor |
| CAS | 143491-57-0 |
| MW: | 247.2 D |
From 54.00€
*
Emtricitabine
Item number: LKT-E5178.5
Emtricitabine is a cytidine nucleoside analog reverse transcriptase inhibitor (NRTI) that is clinically used to treat HIV infection. This antiviral also displays some efficacy in the treatment of hepatitis B infection. Emtricitabine is typically co-administered with other antiretrovirals, it also inhibits telomerase...
| Application: | Reverse transcriptase inhibitor |
| CAS | 143491-57-0 |
| MW: | 247.25 D |
From 87.00€
*
Emtricitabine
Item number: TGM-T6214-100mg
Description: Emtricitabine (FTC) (FTC), a nucleoside reverse transcriptase inhibitor, exhibits inhibition activity against human immunodeficiency virus (HIV) and hepatitis B virus. Target: Reverse Transcriptase, HIV Protease. Smiles: Nc1nc(=O)n(cc1F)[C@@H]1CS[C@H](CO)O1. References: Venhoff N, et al. Antivir Ther,...
| Keywords: | BW1592, Emtriva, FTC |
| Application: | Targets HIV-1 reverse transcriptase / ribonuclease H [EC:2.7.7.49 2.7.7.7 3.1.26.13] (RT) |
| CAS | 143491-57-0 |
| MW: | 247.25 D |
From 43.00€
*
