2 products were found matching "1346547-00-9"!
No results were found for the filter!
GSK583
Item number: Cay19739-10
GSK583 is a selective inhibitor of RIP-like interacting CLARP kinase (RICK also known as RIP2 kinase, IC50 = 5 nM). RIP2 Kinase is a central component of the innate immune system and enables downstream signaling following activation of the pattern recognition receptors NOD1 and NOD2, leading to the production of...
| Keywords: | 6-[(1,1-dimethylethyl)sulfonyl]-N-(5-fluoro-1H-indazol-3-yl)-4-quinolinamine |
| Application: | Selective RIPK2 inhibitor |
| CAS | 1346547-00-9 |
| MW: | 398.5 D |
From 67.00€
*
GSK583
Item number: TGM-T3537-100mg
Description: GSK583 is a highly effective and specific RIP2 kinase inhibitor (IC50: 5 nM). Target: RIP kinase. Smiles: CC(C)(C)S(=O)(=O)c1ccc2nccc(Nc3n[nH]c4ccc(F)cc34)c2c1
| Application: | Selective RIPK2 inhibitor |
| CAS | 1346547-00-9 |
| MW: | 398.45 D |
From 44.00€
*
