Description: H-Phe(4-Ac)-OH, with catalog number T66400 and CAS number 122555-04-8, is a valuable organic compound for life sciences research. Target: Others. Smiles: CC(=O)c1ccc(C[C@H](N)C(O)=O)cc1

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...