2 products were found matching "1135417-31-0"!
No results were found for the filter!
Ac-IEPD-AFC
Item number: Cay42179-1
A fluorogenic substrate for granzyme B, AFC is released upon enzymatic cleavage by granzyme B and its fluorescence can be used to quantify granzyme B activity, ex/em = 400/505 nm, respectively. Formulation: A solid. InChI:...
| Keywords: | Ac-Ile-Glu-Pro-Asp-AFC,... |
| Application: | Fluorogenic granzyme B substrate |
| CAS | 1135417-31-0 |
| MW: | 725.7 D |
From 42.00€
*
Ac-IEPD-AFC
Item number: TGM-TP1128-100mg
Description: Ac-IEPD-AFC (IEPD) is a fluorescent substrate for granzyme B and can be used to measure granzyme B activity. Smiles: C(F)(F)(F)C=1C=2C(=CC(NC([C@@H](NC(=O)[C@H]3N(C([C@@H](NC([C@H]([C@H](CC)C)NC(C)=O)=O)CCC(O)=O)=O)CCC3)CC(O)=O)=O)=CC2)OC(=O)C1. References: Pak SC, et al. SRP-2 is a cross-class...
| Keywords: | IEPD |
| CAS | 1135417-31-0 |
| MW: | 725.67 D |
From 44.00€
*
