3 products were found matching "1127442-82-3"!
No results were found for the filter!
IWR-1
Item number: TGM-T2651-100mg
Description: IWR-1 (IWR-1-endo), a Wnt pathway inhibitor, stabilizes the Axin destruction complex(EC50=0.2 uM). Target: Wnt/beta-catenin. Smiles: O=C(Nc1cccc2cccnc12)c1ccc(cc1)N1C(=O)C2C3CC(C=C3)C2C1=O. References: Lu J, et al. Bioorg Med Chem Lett, 2009, 19(14), 3825-3827.
| Keywords: | endo-IWR 1, IWR-1-endo |
| CAS | 1127442-82-3 |
| MW: | 409.44 D |
From 49.00€
*
IWR-1-endo
Item number: Cay13659-5
Wnt signaling proteins are small secreted proteins that are active in embryonic development, tissue homeostasis, and tumorigenesis. Wnt proteins bind to receptors on the cell surface, initiating a signaling cascade that leads to beta-catenin activation of gene transcription. IWR-1-endo is a potent inhibitor of the...
| Keywords: | 4-[(3aR,4S,7R,7aS)-1,3,3a,4,7,7a-hexahydro-1,3-dioxo-4,7-methano-2H-isoindol-2-yl]-N-8-quinolinyl-benzamide |
| Application: | Wnt response inhibitor |
| CAS | 1127442-82-3 |
| MW: | 409.4 D |
From 92.00€
*
IWR-1-endo
Item number: AG-CR1-3581-M005
Synthetic. Potent and reversible cell permeable Wnt pathway signaling inhibitor. Inhibits Wnt-induced accumulation of beta-catenin, leading to proteasomal degradation of this protein through a destruction complex which consists of Apc, Axin2, CK1 and GSK-3beta. Stabilizes the destruction complex, increasing the...
| Keywords: | 4-[(3aR,4S,7R,7aS)-1,3,3a,4,7,7a-Hexahydro-1,3-dioxo-4,7-methano-2H-isoindol-2-yl]-N-8-quinolinylbenzamide |
| Application: | Potent, reversible cell permeable Wnt pathway signaling inhibitor |
| CAS | 1127442-82-3 |
| MW: | 409,4 D |
88.00€
*
