4 products were found matching "1084893-56-0"!
No results were found for the filter!
(S)-CR8
Item number: LKT-C6801.1
Roscovitine analog, CDK inhibitor.
| Keywords: | 2-(S)-(1-Ethyl-2-hydroxyethylamino)-6-(4-(2-pyridyl)benzyl)-9-isopropylpurine |
| Application: | Roscovitine analog, CDK inhibitor |
| CAS | 1084893-56-0 |
| MW: | 431.54 D |
From 197.00€
*
(S)-CR8
Item number: AG-MR-C0004-M010
Soluble in DMSO or ethanol. Stock solutions can be made up to 10 mM in DMSO. Potent cyclin-dependent kinase (CDK) 1, 2, 5, and 9 inhibitor. Apoptosis inducer. Inhibits the proliferation of various cancer cell lines. Inhibits cysts formation in culture. Casein kinase 1 (CK1delta/epsilon) and Dyrk1A inhibitor....
| Keywords: | 2-(S)-(1-Ethyl-2-hydroxyethylamino)-6-(4-(2-pyridyl)benzyl)-9-isopropylpurine |
| Application: | Cyclin dependent kinase inhibitor |
| CAS | 1084893-56-0 |
| MW: | 431,5 D |
From 286.00€
*
(S)-CR8
Item number: Cay29985-1
(S)-CR8 is a second generation derivative of (R)-roscovitine (Cay-10009569) and an inhibitor of cyclin-dependent kinase 1 (Cdk1/cyclin B), Cdk2/cyclin A, Cdk2/cyclin E, Cdk5/p25, and Cdk9/cyclin T (IC50s = 0.15, 0.08, 0.06, 0.12, and 0.11 µM, respectively). It also inhibits casein kinase CK1delta/epsilon...
| Keywords: | (2S)-2-[[9-(1-methylethyl)-6-[[[4-(2-pyridinyl)phenyl]methyl]amino]-9H-purin-2-yl]amino]-1-butanol |
| Application: | Cyclin-dependent kinase inhibitor |
| CAS | 1084893-56-0 |
| MW: | 431.5 D |
From 67.00€
*
(S)-CR8
Item number: TGM-T23577-100mg
Description: (S)-CR8 is an effective second-generation cyclin-dependent kinase inhibitor. Target: Others. Smiles: C(C)(C)N1C=2C(=C(NCC3=CC=C(C=C3)C4=CC=CC=N4)N=C(N[C@@H](CC)CO)N2)N=C1. References: Billot K, Coquil C, Villiers B, Josselin-Foll B, Desban N, Delehouze C, Oumata N, Le Meur Y, Boletta A, Weimbs T, Grosch...
| Keywords: | (S)CR8, (S) CR8 |
| CAS | 1084893-56-0 |
| MW: | 431.53 D |
From 333.00€
*
