3 products were found matching "10199-89-0"!
No results were found for the filter!
NBD-Cl
Item number: TGM-T19030-1mL
Description: NBD-Cl (NBD chloride) is a nonfluorescent compound that becomes highly fluorescent after reaction with amino or thiol groups. Target: Others. Smiles: [O-][N+](=O)c1ccc(Cl)c2nonc12
| Keywords: | NBD chloride |
| CAS | 10199-89-0 |
| MW: | 199.55 D |
30.00€
*
NBD-Cl (4-Chloro-7-nitrobenzofurazan) *UltraPure grade*
Item number: ABD-825
NBD-Cl reacts with amino groups such as aliphatic amines, amino acids, peptides, and proteins to form highly fluorescent compounds. The NBD-amine adducts have Ex = 464 nm and Em = 512 nm in aqueous solutions.
| Application: | Labeling |
| CAS | 10199-89-0 |
110.00€
*
NBD-Cl
Item number: CDX-C0010-G001
Yellow powder. Soluble in DMF. NBD chloride is nonfluorescent until it reacts with primary or secondary amines to produce a fluorescent product. NBD chloride has been extensively used as a derivatizing reagent for chromatography analysis of amino acids and low molecular weight amines.
| Keywords: | 4-Chloro-7-nitrobenzofurazan |
| Application: | Fluorogenic amine derivatizing reagent |
| CAS | 10199-89-0 |
| MW: | 199,55 D |
From 31.00€
*
