3 products were found matching "1005491-05-3"!
No results were found for the filter!
Tirasemtiv
Item number: LKT-T3568.1
Fast skeletal muscle troponin complex activator.
| Keywords: | CK-2017357 |
| Application: | Improve skeletal muscle function in conditions associated with muscle weakness and fatigue |
| CAS | 1005491-05-3 |
| MW: | 230.27 D |
From 65.00€
*
Tirasemtiv
Item number: Cay26075-10
Tirasemtiv is an activator of the fast skeletal troponin complex. It selectively binds to purified fast skeletal troponin complex (Kd = 40 nM) over slow skeletal (Kd = 3,800 nM) and cardiac troponin complexes. Tirasemtiv (20 µM) slows the rate of calcium release from the fast skeletal troponin complex. It increases...
| Keywords: | CK-2017357, 1-(1-ethylpropyl)-6-ethynyl-1,3-dihydro-2H-imidazo[4,5-b]pyrazin-2-one |
| Application: | Skeletal muscle function improving agent, fast skeletal troponin complex activator |
| CAS | 1005491-05-3 |
| MW: | 230.3 D |
From 73.00€
*
Tirasemtiv
Item number: TGM-T3966-10mg
Description: Tirasemtiv (CK-2017357)(CK 2017357) is a small-molecule fast-skeletal-troponin activator, with a potential treatment for muscle weakness and neuromuscular dysfunction. Target: Others. Smiles: CCC(CC)n1c2nc(cnc2[nH]c1=O)C#C. References: Hwee DT, et al. Fast skeletal muscle troponin activator tirasemtiv...
| Keywords: | CK-2017357 |
| Application: | Skeletal muscle function improving agent |
| CAS | 1005491-05-3 |
| MW: | 230.27 D |
From 38.00€
*
