SSAO/VAP-1 inhibitor 1

Description: SSAO/VAP-1 Inhibitor 1 is a potent compound aimed at inhibiting SSAO/VAP-1, a protein involved in facilitating the translocation of Glucose Transport 4 (GLUT 4) to the cell membrane in adipocytes, thus playing a crucial role in glucose regulation. Additionally, in endothelial cells, this enzyme is responsible for mediating the adherence and infiltration of leukocytes, contributing to inflammatory responses. Given these mechanisms, SSAO/VAP-1 Inhibitor 1 holds considerable potential for research into treatments for inflammation, inflammation-related conditions, diabetes, and diabetes-associated diseases[1]. Target: Others. Smiles: Cl.CC(C)(C)NC(=O)c1ccc2OC(COc2c1)C(\CN)=C\F