Oganomycin GA

Description: Oganomycin GA is a fermentation product from the bacterium Streptomyces (Streptomyces str. oganonensis YG 19Z). By introducing sodium p-hydroxycinnamate into the fermentation medium, Oganomycin A is produced. Under the influence of D-amino acid oxidase, Oganomycin A is converted into the glutaric acid derivative Oganomycin GA, which exhibits greater efficacy against Gram-negative bacteria than against Gram-positive bacteria. Target: Antibacterial. Smiles: N(C(CCCC(O)=O)=O)[C@@]1(OC)[C@@]2(N(C1=O)C(C(O)=O)=C(COC(/C=C/C3=CC=C(OS(=O)(=O)O)C=C3)=O)CS2)[H]