Lucidenic acid B

Description: Lucidenic acid B (Lucidenicacid B), a natural compound extracted from Ganoderma lucidum, induces activation of caspase-9 and caspase-3 and cleavage of PARP, which can induce apoptosis in human leukemia cells through mitochondrial mediation. Lucidenic acid B inhibits PMA-induced invasion of human hepatocellular carcinoma cells by inactivating the MAPK/ERK signaling pathway and decreasing the binding activity of NF-kappaB and AP-1. Lucidenic acid B had no effect on cell cycle and necrotic cells. Target: Apoptosis, Caspase. Smiles: C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)C(=O)CC4)[H])C(=O)[C@@H](O)[C@]1(C)[C@@]([C@@H](CCC(O)=O)C)(CC2=O)[H]. References: Lucidenic acid B induces apoptosis in human leukemia cells via a mitochondria-mediated pathway.J Agric Food Chem. 2008 Jun 11,56(11):3973-80.