Fmoc-L-Dap(Pentynoyl)-OH

Description: Fmoc-L-Dap(Pentynoyl)-OH is a click chemistry reagent featuring an alkyne group, which facilitates the introduction of alkyne functionality into peptide sequences through standard Fmoc/tBu procedures. As an amino acid building block, this compound enables copper-catalyzed azide-alkyne cycloaddition (CuAAC) with azide-containing organic molecules or copper-free coupling reactions with tetrazines. The presence of the pentynoyl group allows for versatile applications in peptide synthesis and modification. Target: ADC Linker. Smiles: C(OC(N[C@@H](CNC(CCC#C)=O)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2