Drimentine B

Description: Drimentine B is a terpenylated diketopiperazine antibiotic originally isolated from Actinomycete bacteria. It is active against Gram-positive and Gram-negative bacteria, fungi, and yeast, and possesses anthelmintic properties. Drimentine B inhibits the proliferation of NS-1 murine beta lymphocyte myeloma cells by 41% and 59% in vitro at concentrations of 50 µg/ml and 100 µg/ml, respectively. Target: Others. Smiles: [H][C@@]12C[C@@]3(C[C@@]4([H])C(=C)CC[C@@]5([H])C(C)(C)CCC[C@]45C)c4ccccc4N[C@@]3([H])N1C(=O)C1=CCCN1C2=O