CQ-Mito

Description: CQ-Mito, a derivative of CQ, demonstrates excellent phototherapeutic efficacy with a PI value of 167. This compound induces cell death through mechanisms such as apoptosis and ferroptosis. It mediates mitochondrial dysfunction, characterized by alterations in mitochondrial morphology and loss of MMP. Additionally, CQ-Mito effectively inhibits tumor growth in 3D multicellular tumor spheroid models. Target: Apoptosis, Ferroptosis, MMP. Smiles: CCN(CC)C1=CC=C2C(OC(C(C3=NC(C=CC(OCC4=CN(CCC[P+](C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)N=N4)=C8)=C8C(N3)=O)=C2)=O)=C1.[Br-]