Betulinic Acid propargyl ester

Description: Betulinic acid propargyl ester is a pentacyclic lupane triterpene and alkyne derivative of betulinic acid .1,2It has been used in click chemistry reactions for the synthesis of cytotoxic anticancer betulinic acid derivatives. Target: Others. Smiles: [H][C@]12[C@@H](CC[C@@]1(CC[C@]1(C)[C@]2([H])CC[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(=O)OCC#C)C(C)=C. References: Thi, T.A.D., Tuyet, N.T.K., The, C.P., et al.Synthesis and cytotoxic evaluation of novel ester-triazole-linked triterpenoid-AZT conjugatesBioorg. Med. Chem. Lett.24(22)5190-5194(2014)