Balovaptan

Balovaptan is an antagonist of the vasopressin V1A receptors (Ki = 0.4 nM for the human receptor). It is selective for V1A receptors over V1B and V2 receptors and oxytocin (OT) receptors (Kis = >6,300, 2,474, and 1,063 nM, respectively, for the human receptors).Formal Name: 8-chloro-5,6-dihydro-5-methyl-1-[trans-4-(2-pyridinyloxy)cyclohexyl]-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. CAS Number: 1228088-30-9. Synonyms: RG7314, Ro 5285119. Molecular Formula: C22H24ClN5O. Formula Weight: 409.9. Purity: >98%. Formulation: (Request formulation change), A solid. Solubility: DMF: 10 mg/ml, DMSO: 10 mg/ml, Ethanol: 25 mg/ml. SMILES: CN1CC2=NN=C([C@]3([H])CC[C@H](CC3)OC4=CC=CC=N4)N2C5=CC=C(Cl)C=C5C1. InChi Code: InChI=1S/C22H24ClN5O/c1-27-13-16-12-17(23)7-10-19(16)28-20(14-27)25-26-22(28)15-5-8-18(9-6-15)29-21-4-2-3-11-24-21/h2-4,7,10-12,15,18H,5-6,8-9,13-14H2,1H3/t15-,18-. InChi Key: GMPZPHGHNDMRKL-RZDIXWSQSA-N.