No results were found for the filter!
Boc-D-Ser(n -propyl)-OH
Item number: CSB-DT2589.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1932113-22-8 |
| MW: | 247.291 D |
Please request pricing for this article.
Fmoc-homoSer(Bzl)-OH
Item number: CSB-DT2590.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1185841-92-2 |
| MW: | 431.488 D |
Please request pricing for this article.
Boc-homoSer(Bzl)-OH
Item number: CSB-DT2591.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 59408-74-1 |
| MW: | 309.362 D |
Please request pricing for this article.
(S)-Fmoc-2-amino- heptanedioic acid 7-tert - butyl ester
Item number: CSB-DT2592.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 159751-46-9 |
| MW: | 453.535 D |
Please request pricing for this article.
Fmoc-(3S,6S)-6-methylmorpholine-3- carboxylic acid
Item number: CSB-DT2593.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1932229-43-0 |
| MW: | 367.401 D |
Please request pricing for this article.
Fmoc-(3S,6R)-6-methylmorpholine-3- carboxylic acid
Item number: CSB-DT2594.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 2381318-90-5 |
| MW: | 367.401 D |
Please request pricing for this article.
Fmoc-2-trifluoromethyl-L- homophenylalanine
Item number: CSB-DT2596.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1260591-46-5 |
| MW: | 469.459 D |
Please request pricing for this article.
Fmoc-3-trifluoromethyl-D- homophenylalanine
Item number: CSB-DT2597.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1260609-38-8 |
| MW: | 469.459 D |
Please request pricing for this article.
H-Pro-Hyp-OH
Item number: CSB-DT2599.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 18684-24-7 |
| MW: | 228.248 D |
Please request pricing for this article.
(S)-Fmoc-2-amino-3- (oxazol-5-yl)propanoic acid
Item number: CSB-DT2602.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1956434-67-5 |
| MW: | 378.384 D |
Please request pricing for this article.
Fmoc-D-N-Me-Thr-OH
Item number: CSB-DT2606.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1931907-74-2 |
| MW: | 355.39 D |
Please request pricing for this article.
N-Fmoc-4-(3-chlorophenyl)- L-phenylalanine
Item number: CSB-DT2608.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Application: | Peptide synthesis |
| CAS | 1380437-47-7 |
| MW: | 497.975 D |
Please request pricing for this article.