Zu "942285-55-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
P11
Artikelnummer: Cay17507-500
Lipoprotein-associated phospholipase A2, also known as platelet activating factor acetylhydrolase (PAF-AH) or phospholipase A2 group 7, hydrolyzes glycerophospholipids to produce lyso-PAF/lyso-phosphatidylcholine and short and/or oxidized fatty acids, many of which have pro-inflammatory or pro-oxidative activities....
| Schlagworte: | (2R,6R)-rel-2-[4-(1,1-dimethylethyl)phenyl]-1,2,5,6-tetrahydro-6-(4-methylphenyl)-1-[(4-methylphenyl)sulfonyl]-3-pyridinec... |
| Anwendung: | PAF-AH1b2/3 inhibitor |
| CAS | 942285-55-4 |
| MW: | 503.7 D |
ab 49,00 €
PAFAH1b2
Artikelnummer: TGM-T24586-10mg
Description: PAFAH1b2 is a selective platelet-activating factor acetylhydrolases 1b2 and 1b3 inhibitor that acts by impairing cancer cell survival. Target: Others. Smiles: Cc1ccc(cc1)[C@@H]1CC=C([C@@H](N1S(=O)(=O)c1ccc(C)cc1)c1ccc(cc1)C(C)(C)C)C(O)=O. References: Liu H, Wang H, Hongmei Z, Zhang H, Liu S. Preliminary...
| Schlagworte: | PAFAH 1 b 2, 3 IN P11, 3INP11, 3-IN-P11, PAFAH-1-b-2 |
| Anwendung: | PAF-AH1b2/3 inhibitor |
| CAS | 942285-55-4 |
| MW: | 503.65 D |
ab 106,00 €
