Zu "79183-19-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Apoptosis Activator 2
Artikelnummer: LKT-A6058.1
Apoptosis inducing agent.
| Schlagworte: | AA-2, Apoptosis activator II, AA-II |
| Anwendung: | Apoptosis inducing agent |
| CAS | 79183-19-0 |
| MW: | 306.14 D |
ab 104,00 €
Apoptosis Activator 2
Artikelnummer: Cay10004176-10
Apoptosis activator 2 promotes the cytochrome c-dependent oligomerization of Apaf-1 into the mature apoptosome, thus increasing procaspase-9 processing and subsequent caspase-3 activation. This compound has been shown to induce apoptosis in leukemia cells (IC50 = 4-9 µM) with weak or no effect on normal cell lines...
| Schlagworte: | AAII, N-(3,4-dichlorobenzyl) Isatin, 1-[(3,4-dichlorophenyl)methyl]-1H-indole-2,3-dione |
| Anwendung: | Cell-permeable caspase activator, Apaf-1 oligomerization |
| CAS | 79183-19-0 |
| MW: | 306.1 D |
ab 57,00 €
MDK83190
Artikelnummer: TGM-T1772-100mg
Description: MDK83190 (Apoptosis Activator 2) is a potent apoptosis activator, induceing caspase-3 activation, PARP cleavage, and DNA fragmentation . Target: Caspase, Apoptosis. Smiles: ClC1=C(Cl)C=C(CN2C(=O)C(=O)C3=C2C=CC=C3)C=C1. References: Nguyen JT, et al. Proc Natl Acad Sci U S A, 2003, 100(13), 7533-7538.
| Schlagworte: | Apoptosis Activator 2 |
| Anwendung: | Cell-permeable caspase activator, Apaf-1 oligomerization |
| CAS | 79183-19-0 |
| MW: | 306.14 D |
ab 33,00 €
