2,3-dihydrothieno-Thiadiazole Carboxylate

1,2,3-Thiadiazoles have diverse applications in medicine and agriculture, such as bactericides, fungicides, and antiviral agents. 2,3-dihydrothieno-Thiadiazole carboxylate (MTCC), 100 µM, both inhibits and inactivates certain microsomal CYP450 enzymes (CYP2E1 and CYP2B4), but not others (CYP1A2), with inactivation occurring in a mechanism-based manner.Formal Name: methylthieno[3,2-d][1,2,3]thiadiazole-6-carboxylate. CAS Number: 152467-47-5. Synonyms: MTCC. Molecular Formula: C6H4N2O2S2. Formula Weight: 200.2. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 30 mg/ml, DMSO: 30 mg/ml, DMSO:PBS(pH 7.2) (1:2): 0.3 mg/ml, Ethanol: 2 mg/ml. lambdamax: 237 nm. SMILES: COC(=O)c1csc2snnc12. InChi Code: InChI=1S/C6H4N2O2S2/c1-10-5(9)3-2-11-6-4(3)7-8-12-6/h2H,1H3. InChi Key: FMCBCIKSEQJAGA-UHFFFAOYSA-N.