LHRH Acetate Salt

Luteinizing hormone-releasing hormone (LHRH or Gonadotropin-releasing hormone [GnRH]) is an endogenous peptide hormone that binds the GnRH receptor, stimulating secretion of reproductive hormones (such as luteinizing hormone [LH ] and follicle-stimulating hormone [FSH]) from the pituitary gland. Analogs of GnRH are clinically used to treat hormone-dependent diseases such as prostate and breast cancer, hyperplasia, and endometriosis. SMILES: CC(C)CC(C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NCC(=O)N)NC(=O)CNC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CO)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CC5=CN=CN5)NC(=O)C6CCC(=O)N6