Tasiamide B

Description: Tasiamide B is a linear peptide and Cathepsin D inhibitor discovered in the marine cyanobacterium Symploca sp. This compound serves as an excellent template for the development of aspartic protease inhibitors. Tasiamide B effectively targets skin cancer through its strong interaction with the protein HSP90. Target: HSP. Smiles: C([C@@H](CC1=CC=CC=C1)N(C([C@@H](NC([C@@H](NC(C[C@@H]([C@H](CC2=CC=CC=C2)NC([C@@H](N(C([C@@H](NC([C@H](C)O)=O)C(C)C)=O)C)CCC(N)=O)=O)O)=O)CC(C)C)=O)C)=O)C)(=O)N3[C@H](C(OC)=O)CCC3