p53 (232-240)

Description: p53 (232-240), a peptide derived from the 232-240 amino acid sequence of the human tumor suppressor protein p53, improves its binding affinity to the Major Histocompatibility Complex (MHC). This enhancement increases the immunogenicity of the peptide, boosting the immune system's response to tumor antigens. p53 (232-240) is valuable in the development of cancer vaccines and aids in researching how the immune system recognizes and eliminates tumor cells. Smiles: [C@H](CC1=CC=C(O)C=C1)(C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCSC)C(O)=O)=O)CS)=O)CO)=O)CO)=O)CC(N)=O)=O)CS)=O)CCSC)=O)NC([C@H](CCCCN)N)=O