NY-ESO-1 (157âEUR"165) peptide

Description: NY-ESO-1 (157â?"165) peptide is a peptide derived from the NY-ESO-1 protein and has the ability to activate the immune system. It is particularly effective in individuals positive for HLA-A2, as it can be recognized by CD8+ T cells, thus triggering an immune response. The presence of NY-ESO-1 (157â?"165) peptide in various tumors makes it a potential target for cancer immunotherapy. This peptide is also utilized in research focusing on cancer immunotherapy. Smiles: C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)CS)=O)CCC(N)=O)=O)[C@@H](C)O)=O)[C@H](CC)C)=O)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CO)N)=O)CC(C)C)=O)CC(C)C)=O)CCSC)=O)C=1C=2C(NC1)=CC=CC2