NDI-Lyso

Description: NDI-Lyso is an anticancer agent targeting lysosomes, functioning through an enzyme-induced self-assembly (EISA) mechanism catalyzed by Cathepsin B. In cancer cell lysosomes, it forms rigid long fibers, promoting lysosomal swelling, lysosomal membrane permeabilization (LMP), and membrane disruption. This leads to non-classical caspase-independent apoptosis (Apoptosis). NDI-Lyso demonstrates significant selective anticancer activity across various cancer cell lines and drug-resistant cancer cells (IC50 approximately 10 µM), while exhibiting low toxicity to normal cells (IC50 > 60 µM). Target: Apoptosis, Caspase. Smiles: O=C1C=2C3=C4C(C(=O)N(CCCCCC)C(=O)C4=CC2)=CC=C3C(=O)N1CCC(N[C@H](C(N[C@@H](CC5=CC=CC=C5)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCCCN)C(O)=O)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)=O)CC6=CC=CC=C6)=O