MBP Ac1-9

Description: MBP Ac1-9, a peptide fragment of myelin basic protein (MBP), serves as an immunodominant epitope in experimental autoimmune encephalomyelitis (EAE) models, where it induces an immune response in T cells leading to pathological changes similar to multiple sclerosis. This peptide is used in research focused on T cell activation and autoimmune responses. Smiles: C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(C)=O)C)=O)CO)=O)CCC(N)=O)=O)CCCCN)=O)CCCNC(=N)N)(=O)N1[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)CCC(N)=O)=O)CO)=O)CCC1