HYNIC-iPSMA TFA

Description: HYNIC-iPSMA TFA serves as a ligand in the molecular imaging of tumors. It comprises HYNIC (6-hydrazinonicotinamide), which is employed to bind radioactive isotopes to target molecules, and iPSMA (Inhibitor of Prostate-Specific Membrane Antigen), a specific inhibitor of PSMA. 68GA-labeled iPSMA is utilized for detecting prostate cancer through PET imaging. Additionally, 99mTc-EDDA/HYNIC-iPSMA TFA exhibits remarkable specificity and sensitivity. Target: PSMA. Smiles: C(C(O)=O)(F)(F)F.C([C@H](NC(=O)C=1C=CC(=NN)NC1)C(NCCCC[C@H](NC(N[C@@H](CCC(O)=O)C(O)=O)=O)C(O)=O)=O)C2=CC3=C(C=C2)C=CC=C3