Humanized anti-tac (HAT) binding peptide

Description: Humanized anti-tac (HAT) binding peptide is a peptide that specifically binds to the Fc region of HAT. HAT is a humanized monoclonal antibody targeting the low-affinity p55 subunit of the interleukin IL-2 receptor. The peptide can be utilized in the development of affinity chromatography media for the purification of specific monoclonal antibodies. Smiles: C(N[C@H](C(N[C@@H](CC1=CN=CN1)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC(C)C)C(O)=O)=O)CC(C)C)=O)C)=O)[C@@H](C)O)=O)CC(C)C)=O)[C@@H](C)O)=O)CO)=O)CCCNC(=N)N)=O)=O)[C@H](CC)C)(=O)[C@H]2N(C([C@H](CCC(O)=O)N)=O)CCC2