GNQWFI

Description: GNQWFI, an anti-Flt1 peptide, functions as a VEGFR1-specific antagonist. It inhibits interactions between VEGFR1 and various ligands, such as VEGFA, VEGFB, and placental growth factor (PIGF), and suppresses VEGF-induced endothelial cell migration and tubulogenesis. GNQWFI holds potential for research in cancer, asthma, and other ocular diseases. Target: VEGFR. Smiles: C([C@@H](C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H]([C@H](CC)C)C(O)=O)=O)=O)NC([C@@H](NC([C@@H](NC(CN)=O)CC(N)=O)=O)CCC(N)=O)=O)C=2C=3C(NC2)=CC=CC3