CAY10679

Description: CAY10679, an anionic oligopeptide-based bola-amphiphile, features a central hexane segment bordered by a glycylglycine group at each end, establishing pronounced hydrophilic and hydrophobic regions. This amphiphilic peptide's propensity for self-assembling into microtubes in aqueous acidic solutions has been explored. Such bola-amphiphiles hold significant potential in the development of nanotubes, nanovesicles, nanowires, and nanocarriers for drug delivery, among various bionanotechnology applications. Target: Others. Smiles: OC(=O)CNC(=O)CNC(=O)CCCCCCC(=O)NCC(=O)NCC(O)=O