1-Arachidoyl Lysophosphatidic Acid sodium

Description: 1-Arachidoyl lysophosphatidic acid (1-arachidoyl LPA), a glycerophospholipid with arachidic acid at the sn-1 position, functions as an agonist for lysophosphatidic acid receptor 1 (LPA1). It effectively induces calcium mobilization in primary human lung fibroblasts at an EC50 value of 3.6 µM, given these cells inherently express LPA1 but lack expression of LPA2-LPA6 receptors. Additionally, at a concentration of 2.5 µM, 1-arachidoyl LPA binds to the ligand-binding domain of peroxisome proliferator-activated receptor gamma (PPARgamma) in a cell-free environment. This compound has also been detected in human urine. Smiles: O=C(OC[C@@H](O)COP(O)([O-])=O)CCCCCCCCCC CCCCCCCCC.[Na+]