Lumateperone

Lumateperone is an atypical antipsychotic. It selectively binds to the serotonin (5-HT) receptor subtype 5-HT2A over 5-HT1A and 5-HT2C receptors (Kis = 0.54, 1,480, and 173 nM, respectively). Lumateperone also binds to dopamine D1, D2, and D4 receptors (Kis = 52, 32, and 108 nM, respectively), alpha1A- and alpha1B-adrenergic receptors (Kis = 73 and 31 nM, respectively), and the 5-HT transporter (SERT, Ki = 61 nM). It reduces head-twitch behavior induced by the 5-HT2A agonist quipazine in rats (ED50 = 0.12 mg/kg). Formulations containing lumateperone have been used in the treatment of schizophrenia.. SMILES: O=C(C1=CC=C(F)C=C1)CCCN2CC[C@@]3([H])[C@@](C4=CC=CC5=C4N3CCN5C)([H])C2. InChi Code: InChI=1S/C24H28FN3O/c1-26-14-15-28-21-11-13-27(16-20(21)19-4-2-5-22(26)24(19)28)12-3-6-23(29)17-7-9-18(25)10-8-17/h2,4-5,7-10,20-21H,3,6,11-16H2,1H3/t20-,21-/m0/s1. InChi Key: HOIIHACBCFLJET-SFTDATJTSA-N