Zu "313368-91-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lumateperone
Artikelnummer: Cay45296-100
Lumateperone is an atypical antipsychotic. It selectively binds to the serotonin (5-HT) receptor subtype 5-HT2A over 5-HT1A and 5-HT2C receptors (Kis = 0.54, 1,480, and 173 nM, respectively). Lumateperone also binds to dopamine D1, D2, and D4 receptors (Kis = 52, 32, and 108 nM, respectively), alpha1A- and...
| Schlagworte: | ITI-007, ITI-722,... |
| Anwendung: | Atypical antipsychotic |
| CAS | 313368-91-1 |
| MW: | 393.51 D |
ab 64,00 €
Lumateperone
Artikelnummer: TGM-T21069-100mg
Description: Lumateperone (ITI 722) is a 5HT2A receptor antagonist and a dopamine receptor phosphoprotein modulator (DPPM). Target: 5-HT Receptor, Dopamine Receptor. Smiles: [H][C@]12CCN(CCCC(=O)c3ccc(F)cc3)C[C@@]1([H])c1cccc3N(C)CCN2c13
| Schlagworte: | ITI722 , ITI 722 , ITI007 , ITI-007 |
| Anwendung: | Targets 5-hydroxytryptamine receptor 2 (HTR2) |
| CAS | 313368-91-1 |
| MW: | 393.5 D |
ab 32,00 €
