L-Mimosine

L-Mimosine is a non-protein amino acid that can be isolated from certain plants and fungi. It chelates iron and copper and has been shown to reduce iron overload in animal models. L-Mimosine inhibits certain enzymes that contain iron or copper, including arginase (IC50 = 3.7 µM), polyphenoloxidase, and dopamine hydroxylase. It also inhibits the iron-containing enzyme deoxyhypusine hydroxlase, preventing the synthesis of the eukaryotic initiation factor 5A and blocking cell cycling.Formal Name: (alphaS)-amino-3-hydroxy-4-oxo-1(4H)-pyridinepropanoic acid. CAS Number: 500-44-7. Synonyms: Leucenol, NSC 69188. Molecular Formula: C8H10N2O4. Formula Weight: 198.2. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: :. lambdamax: 216, 283 nm. SMILES: OC1=CN(C[C@H](N)C(O)=O)C=CC1=O. InChi Code: InChI=1S/C8H10N2O4/c9-5(8(13)14)3-10-2-1-6(11)7(12)4-10/h1-2,4-5,12H,3,9H2,(H,13,14)/t5-/m0/s1. InChi Key: WZNJWVWKTVETCG-YFKPBYRVSA-N.