Zu "500-44-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Mimosine
Artikelnummer: TGM-T6569-25mg
Description: L-Mimosine (Leucenol) is an antineoplastic alanine-substituted pyridine derivative isolated from Leucena glauca and acts as an iron chelator. Target: Others. Smiles: N[C@@H](Cn1ccc(=O)c(O)c1)C(O)=O. References: Chung LC, et al. Am J Physiol Cell Physiol. 2012, 302(4), C676-685.
| Schlagworte: | L-Mimosine, Leucenol, NSC 69188, Leucenine |
| Anwendung: | Iron / copper chelator, iron/copper-containing enzyme inhibitor |
| CAS | 500-44-7 |
| MW: | 198.18 D |
30,00 €
L-Mimosine
Artikelnummer: Cay14337-100
L-Mimosine is a non-protein amino acid that can be isolated from certain plants and fungi. It chelates iron and copper and has been shown to reduce iron overload in animal models. L-Mimosine inhibits certain enzymes that contain iron or copper, including arginase (IC50 = 3.7 µM), polyphenoloxidase, and dopamine...
| Schlagworte: | Leucenol, NSC 69188, (alphaS)-amino-3-hydroxy-4-oxo-1(4H)-pyridinepropanoic acid |
| Anwendung: | Iron / copper chelator, iron/copper-containing enzyme inhibitor |
| CAS | 500-44-7 |
| MW: | 198.2 D |
ab 35,00 €
