GSK4112

Description: GSK4112 (SR6452) is a Rev-erbalpha agonist with an EC50 of 0.4 µM and serves as a small molecule chemical probe for studying the cell biology of the nuclear heme receptor Rev-erbalpha. Target: REV-ERB, Apoptosis, Autophagy. Smiles: CC(C)(C)OC(=O)CN(Cc1ccc(s1)[N+]([O-])=O)Cc1ccc(Cl)cc1. References: Grant D, et al. GSK4112, a small molecule chemical probe for the cell biology of the nuclear heme receptor Rev-erbalpha. ACS Chem Biol. 2010 Oct 15,5(10):925-932.