Zu "1216744-19-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK4112
Artikelnummer: Cay11931-5
REV-ERBalpha is a nuclear hormone receptor with roles in circadian rhythm, adipogenesis, lipid metabolism, and inflammation. It binds porphoryin heme and in response to fluctuations in heme levels in cells it recruits corepressors such as NCoR and HDAC3 to repress the transcription of key genes involved in metabolic...
| Schlagworte: | N-[(4-chlorophenyl)methyl]-N-[(5-nitro-2-thienyl)methyl]-glycine, 1,1-dimethylethyl ester |
| Anwendung: | Metabolic/circadian pathway studies |
| CAS | 1216744-19-2 |
| MW: | 396.9 D |
ab 101,00 €
GSK4112
Artikelnummer: TGM-T5045-100mg
Description: GSK4112 (SR6452) is a Rev-erbalpha agonist with an EC50 of 0.4 µM and serves as a small molecule chemical probe for studying the cell biology of the nuclear heme receptor Rev-erbalpha. Target: REV-ERB, Apoptosis, Autophagy. Smiles: CC(C)(C)OC(=O)CN(Cc1ccc(s1)[N+]([O-])=O)Cc1ccc(Cl)cc1. References:...
| Schlagworte: | 1,1-Dimethylethyl-N-[(4-chlorophenyl)methyl]-N-[(5-nitro-2-thienyl)methyl])glycinate , SR6452 |
| Anwendung: | Metabolic/circadian pathway studies |
| CAS | 1216744-19-2 |
| MW: | 396.89 D |
ab 30,00 €
