Zu "K07466" wurden 57 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-RPA1
Artikelnummer: ABS-KC-6153.100
Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form during DNA replication or upon DNA stress. It prevents their reannealing and in parallel, recruits and activates different proteins and complexes involved in DNA...
| Schlagworte: | Anti-Replication protein A 70 kDa DNA-binding subunit, Anti-RP-A p70, Anti-Replication factor A protein 1, Anti-RF-A... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, monkey, mouse, rat |
ab 232,00 €
HAMNO
Artikelnummer: TGM-T4311-100mg
Description: HAMNO (NSC-111847) is a protein interaction inhibitor of replication protein A (RPA). Target: DNA/RNA Synthesis. Smiles: Oc1ccccc1N\C=C1/C(=O)C=Cc2ccccc12. References: Glanzer JG, et al. RPA inhibition increases replication stress and suppresses tumor growth. Cancer Res. 2014 Sep 15,74(18):5165-72.
| Schlagworte: | NSC111847 |
| Anwendung: | Replication protein A (RPA) inhibitor |
| CAS | 138736-73-9 |
| MW: | 263.29 D |
ab 46,00 €
NSC15520
Artikelnummer: TGM-T81640-10mg
Description: NSC15520, a small-molecule inhibitor of Replication Protein A (RPA), selectively targets the N-terminal DNA binding domain (DBD) of RPA, preventing its interaction with p53 and RAD9. Additionally, NSC15520 impedes the helix destabilization of duplex DNA (dsDNA) oligonucleotides, playing a role in...
| Anwendung: | RPA70 dsDNA binding inhibitor |
| CAS | 730960-98-2 |
| MW: | 418.52 D |
ab 77,00 €
RPA1 Protein, Human, Recombinant (His & SUMO)
Artikelnummer: TGM-TMPH-02026-100ug
Description: RPA1 Protein, Human, Recombinant (His & SUMO) is expressed in E. coli expression system with N-6xHis-SUMO tag. The predicted molecular weight is 84.0 kDa and the accession number is P27694.
| Schlagworte: | Replication protein A 70 kDa DNA-binding subunit, Single-stranded DNA-binding protein, Replication factor A protein 1, RPA1 |
| MW: | 84.0 kD |
ab 198,00 €
Replication protein A 70kDa DNA-binding subunit (RPA1),...
Artikelnummer: CSB-EP020088HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 2-616aa. Protein Length: Full Length of Mature Protein. Tag Info: N-terminal 6xHis-SUMO-tagged. Target Protein Sequence: VGQLSEGAIA AIMQKGDTNI KPILQVINIR PITTGNSPPR YRLLMSDGLN TLSSFMLATQ LNPLVEEEQL SSNCVCQIHR FIVNTLKDGR RVVILMELEV LKSAEAVGVK...
| Schlagworte: | RPA1, REPA1, Recombinant Human Replication protein A 70kDa DNA-binding subunit (RPA1) |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 84 kD |
ab 219,00 €
Anti-RPA70
Artikelnummer: A300-241A
Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form during DNA replication or upon DNA stress. It prevents their reannealing and in parallel, recruits and activates different proteins and complexes involved in DNA...
| Schlagworte: | Anti-RPA1, Anti-REPA1 |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €
Anti-RPA70, clone 8C3-D12-H10
Artikelnummer: ARG54143.100
Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form during DNA replication or upon DNA stress. It prevents their reannealing and in parallel, recruits and activates different proteins and complexes involved in DNA...
| Schlagworte: | Anti-RPA1, Anti-REPA1 |
| Anwendung: | WB, ICC, IF, IP |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, monkey, mouse, rat |
658,00 €
Anti-RPA70 / RPA1
Artikelnummer: NSJ-R32042
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Replication protein A 70 kDa DNA-binding subunit is a protein that in humans is encoded by the RPA1 gene. This gene is mapped to chromosome 17p13.3. Replication protein A (RPA) is a heterotrimeric single-strand DNA (ssDNA)-binding protein essential for DNA...
| Schlagworte: | Anti-RPA1, Anti-REPA1, RPA70 Antibody / RPA1 |
| Anwendung: | WB, IF, FC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
772,00 €
Anti-RPA70
Artikelnummer: NSJ-R33266-100UG
0.5 mg/ml in 1X TBS, pH7.3, with 0.5% BSA (US sourced) and 0.02% sodium azide. Additional name(s) for this target protein: Replication protein A1, 70kDa, RPA1 Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form...
| Schlagworte: | Anti-RPA1, Anti-REPA1, RPA70 Antibody |
| Anwendung: | WB, ELISA (peptide) |
| Wirt: | Goat |
| Spezies-Reaktivität: | human, mouse |
790,00 €
Anti-RPA70 (IHC)
Artikelnummer: IHC-00409
Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form during DNA replication or upon DNA stress. It prevents their reannealing and in parallel, recruits and activates different proteins and complexes involved in DNA...
| Schlagworte: | Anti-RPA1, Anti-REPA1 |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €
Anti-RPA70
Artikelnummer: ARG57862.100
Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form during DNA replication or upon DNA stress. It prevents their reannealing and in parallel, recruits and activates different proteins and complexes involved in DNA...
| Schlagworte: | Anti-RPA1, Anti-REPA1 |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
658,00 €
Anti-RPA1
Artikelnummer: E-AB-64035.120
Protein function: As part of the heterotrimeric replication protein A complex (RPA/RP-A), binds and stabilizes single-stranded DNA intermediates, that form during DNA replication or upon DNA stress. It prevents their reannealing and in parallel, recruits and activates different proteins and complexes involved in DNA...
| Schlagworte: | Anti-RPA1, Anti-REPA1, RPA1 Polyclonal Antibody |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 243,00 €