Zu "K02684" wurden 25 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DNA Primase Inhibitor-13
Artikelnummer: TGM-T27194-100mg
Description: DNA Primase Inhibitor-13 is a novel inhibitor of DNA primase. Target: Others. Smiles: C(CC(O)=O)C=1C=2C(NC1C(OCC)=O)=CC=C(N(=O)=O)C2
| Anwendung: | DNA Primase inhibitor |
| CAS | 261363-54-6 |
| MW: | 306.27 D |
ab 1.520,00 €
Anti-PRIM1
Artikelnummer: CSB-PA003853.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-p49, Anti-PRIM1, Anti-DNA primase small subunit, Anti-DNA primase 49 kDa subunit, AI324982 antibody, DNA primase 49... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-PRIM1
Artikelnummer: CSB-PA972371.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Schlagworte: | Anti-p49, Anti-PRIM1, Anti-DNA primase small subunit, Anti-DNA primase 49 kDa subunit, AI324982 antibody, DNA primase 49... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
283,00 €
DNA primase small subunit (PRIM1), human, recombinant
Artikelnummer: CSB-EP018680HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 1-420aa. Protein Length: Full Length. Tag Info: N-terminal 6xHis-SUMO-tagged. Target Protein Sequence: METFDPTELP ELLKLYYRRL FPYSQYYRWL NYGGVIKNYF QHREFSFTLK DDIYIRYQSF NNQSDLEKEM QKMNPYKIDI GAVYSHRPNQ HNTVKLGAFQ AQEKELVFDI DMTDYDDVRR CCSSADICPK...
| Schlagworte: | p49, PRIM1, DNA primase small subunit, DNA primase 49 kDa subunit, Recombinant Human DNA primase small subunit (PRIM1) |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 65.9 kD |
ab 219,00 €
Anti-PRIM1
Artikelnummer: ATA-HPA040010.100
Protein function: Catalytic subunit of the DNA primase complex and component of the DNA polymerase alpha complex (also known as the alpha DNA polymerase-primase complex) which play an essential role in the initiation of DNA synthesis (PubMed:9268648, PubMed:9705292, PubMed:17893144). During the S phase of the cell...
| Schlagworte: | Anti-p49, Anti-PRIM1, Anti-DNA primase small subunit, Anti-DNA primase 49 kDa subunit |
| Anwendung: | ICC, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 358,00 €
Anti-pri-1
Artikelnummer: CSB-PA018680XA01CXY.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-pri-1, Anti-F58A4.4, EC=2.7.7.-, Anti-DNA primase small subunit, pri-1 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Caenorhabditis elegans |
ab 1.529,00 €
Anti-PRI1
Artikelnummer: CSB-PA018680XA01SVG.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-PRI1, Anti-YIB8C, Anti-YIR008C, EC=2.7.7.-, Anti-DNA primase small subunit, Anti-DNA primase 48 kDa subunit, Anti-Pol... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) (Baker's yeast) |
ab 1.529,00 €
Anti-pri1
Artikelnummer: CSB-PA018680XA01SXV.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-DNA primase 1, Anti-DNA primase small subunit, pri1 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Schizosaccharomyces pombe (strain 972 / ATCC 24843) (Fission yeast) |
ab 1.529,00 €
PRIM1 (human), recombinant protein
Artikelnummer: ABS-PP-5713.20
| Schlagworte: | DNA primase small subunit, DNA primase 49 kDa subunit, p49, Recombinant Human PRIM1 Protein |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 28 kD |
ab 90,00 €
Anti-PRIM1
Artikelnummer: CSB-PA018680LA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: PRIM1. Antigen Species: Human
| Schlagworte: | Anti-p49, Anti-PRIM1, Anti-DNA primase small subunit, Anti-DNA primase 49 kDa subunit, AI324982 antibody, DNA primase 49... |
| Anwendung: | ELISA, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-PRIM1, HRP conjugated
Artikelnummer: CSB-PA018680LB01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: PRIM1. Antigen Species: Human
| Schlagworte: | Anti-p49, Anti-PRIM1, Anti-DNA primase small subunit, Anti-DNA primase 49 kDa subunit, AI324982 antibody, DNA primase 49... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-PRIM1, Biotin conjugated
Artikelnummer: CSB-PA018680LD01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: PRIM1. Antigen Species: Human
| Schlagworte: | Anti-p49, Anti-PRIM1, Anti-DNA primase small subunit, Anti-DNA primase 49 kDa subunit, AI324982 antibody, DNA primase 49... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €