Zu "K00908" wurden 27 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-CaMKK alpha
Artikelnummer: A302-669A
Protein function: Calcium/calmodulin-dependent protein kinase that belongs to a proposed calcium-triggered signaling cascade involved in a number of cellular processes. Phosphorylates CAMK1, CAMK1D, CAMK1G and CAMK4. Involved in regulating cell apoptosis. Promotes cell survival by phosphorylating AKT1/PKB that...
| Schlagworte: | Anti-CAMKK1, Anti-CAMKKA, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
STO-609
Artikelnummer: Cay31358-1
STO-609 is a calcium/calmodulin-dependent protein kinase kinase (CaMKK) inhibitor (IC50s = 120 and 40 ng/ml for CaMKKalpha and CaMKKbeta, respectively). It is selective for CaMKKs over CaMKI, CaMKII, CaMKIV, MLCK, PKC, PKA, and p42 MAPK (IC50s = >10,000 ng/ml for all). STO-609 inhibits phosphorylation of CaMKI and...
| Schlagworte: | 7-oxo-7H-benzimidazo[2,1-a]benz[de]isoquinoline-3-carboxylic acid |
| Anwendung: | CaMKK inhibitor |
| CAS | 52029-86-4 |
| MW: | 314.3 D |
ab 56,00 €
STO-609
Artikelnummer: TGM-T3546-1mg
Description: STO-609 is a specific and cell-permeable inhibitor of the Ca2+/calmodulin-dependent protein kinase kinase (CaM-KK) for recombinant CaM-KKalpha/KKbeta (Ki: 80/15 ng/mL). Target: Autophagy, AMPK, CaMK. Smiles: C1=CC=C2C(=C1)N=C3N2C(=O)C4=CC=CC5=C(C=CC3=C54)C(=O)O
| Schlagworte: | STO 609 |
| Anwendung: | CaMKK inhibitor |
| CAS | 52029-86-4 |
| MW: | 314.29 D |
ab 34,00 €
Anti-CaMKK alpha
Artikelnummer: A302-668A
Protein function: Calcium/calmodulin-dependent protein kinase that belongs to a proposed calcium-triggered signaling cascade involved in a number of cellular processes. Phosphorylates CAMK1, CAMK1D, CAMK1G and CAMK4. Involved in regulating cell apoptosis. Promotes cell survival by phosphorylating AKT1/PKB that...
| Schlagworte: | Anti-CAMKK1, Anti-CAMKKA, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Anti-CaMKK
Artikelnummer: NSJ-R30595
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Calcium/calmodulin-dependent protein kinase kinase 1 is an enzyme that in humans is encoded by the CAMKK1 gene. The product of this gene belongs to the Serine/Threonine protein kinase family, and to the Ca(2+)/calmodulin-dependent protein kinase subfamily. This...
| Schlagworte: | Anti-Camkk, Anti-Camkk1, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | WB, IHC (paraffin) |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
790,00 €
Anti-CAMKK
Artikelnummer: NSJ-F50751-0.08ML
In 1X PBS, pH 7.4, with 0.09% sodium azide. CAMKK1 belongs to the Serine/Threonine protein kinase family, and to the Ca(2+)/calmodulin-dependent protein kinase subfamily. This protein plays a role in the calcium/calmodulin-dependent (CaM) kinase cascade. Protein function: Calcium/calmodulin-dependent protein kinase...
| Schlagworte: | Anti-CAMKKA, Anti-CAMKK1, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 361,00 €
Anti-CAMKK1
Artikelnummer: NSJ-F50752-0.08ML
In 1X PBS, pH 7.4, with 0.09% sodium azide. CAMKK1 belongs to the Serine/Threonine protein kinase family, and to the Ca(2+)/calmodulin-dependent protein kinase subfamily. This protein plays a role in the calcium/calmodulin-dependent (CaM) kinase cascade. Protein function: Calcium/calmodulin-dependent protein kinase...
| Schlagworte: | Anti-CAMKKA, Anti-CAMKK1, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 361,00 €
Anti-CAMKK1
Artikelnummer: E-AB-52514.120
The product of this gene belongs to the Serine/Threonine protein kinase family, and to the Ca(2+)/calmodulin-dependent protein kinase subfamily. This protein plays a role in the calcium/calmodulin-dependent (CaM) kinase cascade. Three transcript variants encoding two distinct isoforms have been identified for this...
| Schlagworte: | Anti-CAMKKA, Anti-CAMKK1, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | WB, IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €
Anti-CAMKK1
Artikelnummer: ATA-HPA028062.100
Protein function: Calcium/calmodulin-dependent protein kinase that belongs to a proposed calcium-triggered signaling cascade involved in a number of cellular processes. Phosphorylates CAMK1, CAMK1D, CAMK1G and CAMK4. Involved in regulating cell apoptosis. Promotes cell survival by phosphorylating AKT1/PKB that...
| Schlagworte: | Anti-CAMKK1, Anti-CAMKKA, Anti-CaMKK 1, Anti-CaM-KK 1, Anti-CaMKK alpha, Anti-CaM-KK alpha, EC=2.7.11.17, Anti-CaM-kinase... |
| Anwendung: | ICC, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
491,00 €
Autocamtide 2 (trifluoroacetate salt)
Artikelnummer: Cay24788-1
Autocamtide 2 is a peptide substrate for calcium/calmodulin-dependent protein kinase (CaMK) and CaMKII. It is selectively phosphorylated by CaMK over bovine brain protein kinase C (PKC, Kms = 2 and >50 µM, respectively). Autocamtide 2 phosphorylation can be used to quantify CaMK and CaMKII activity.Formal Name:...
| Schlagworte: | L-lysyl-L-lysyl-L-alanyl-L-leucyl-L-arginyl-L-arginyl-L-glutaminyl-L-alpha-glutamyl-L-threonyl-L-valyl-L-alpha-aspartyl-L-... |
| Anwendung: | Calcium/calmodulin-dependent protein kinase peptide substrate |
| MW: | 1527.8 D |
137,00 €
Anti-CAMKK1
Artikelnummer: ABS-KC-2092.100
Protein function: Calcium/calmodulin-dependent protein kinase that belongs to a proposed calcium-triggered signaling cascade involved in a number of cellular processes. Phosphorylates CAMK1, CAMK1D, CAMK1G and CAMK4. Involved in regulating cell apoptosis. Promotes cell survival by phosphorylating AKT1/PKB that...
| Schlagworte: | Anti-Calcium/calmodulin-dependent protein kinase kinase 1, Anti-CaM-KK 1, Anti-CaM-kinase kinase 1, Anti-CaMKK 1,... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-CAMKK1
Artikelnummer: ABS-KC-2093.100
Protein function: Calcium/calmodulin-dependent protein kinase that belongs to a proposed calcium-triggered signaling cascade involved in a number of cellular processes. Phosphorylates CAMK1, CAMK1D, CAMK1G and CAMK4. Involved in regulating cell apoptosis. Promotes cell survival by phosphorylating AKT1/PKB that...
| Schlagworte: | Anti-Calcium/calmodulin-dependent protein kinase kinase 1, Anti-CaM-KK 1, Anti-CaM-kinase kinase 1, Anti-CaMKK 1,... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €