Zu "84638-55-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ACETOXYVALERENIC ACID
Artikelnummer: TGM-TN6767-10mg
Description: Acetoxyvalerenic acid, a natural compound isolated from valerian (Valeriana officinalis), exhibits significant pharmacological properties. Target: Others. Smiles: C(=C(/C(O)=O)\C)\[C@H]1C=2[C@]([C@H](OC(C)=O)CC2C)([C@H](C)CC1)[H]. References: Gabriele Trauner, et al. Modulation of GABAA receptors by...
| CAS | 84638-55-1 |
| MW: | 292.37 D |
ab 309,00 €
Acetoxyvalerenic Acid
Artikelnummer: Cay31516-1
Acetoxyvalerenic acid is a sesquiterpenic acid that has been found in Valeriana roots. It is cytotoxic to GLC-4 and COLO 320 cells (IC50s = 111 and 124 µM, respectively).Formal Name: (2E)-3-[(1R,4S,7R,7aR)-1-(acetyloxy)-2,4,5,6,7,7a-hexahydro-3,7-dimethyl-1H-inden-4-yl]-2-methyl-2-propenoic acid. CAS Number:...
| Schlagworte: | Acetylvalerenolic Acid,... |
| Anwendung: | Sesquiterpenic acid |
| CAS | 84638-55-1 |
| MW: | 292.4 D |
ab 69,00 €
