Zu "7380-40-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bergamottin
Artikelnummer: TGM-T5S0669-10mg
Description: 1. Bergamottin (5-Geranoxypsoralen) can significantly reduce blood glucose and increase glucose tolerance and insulin sensitivity in KK-Aydiabetic mice. Target: P450. Smiles: CC(C)=CCC\C(C)=C\COc1c2ccoc2cc2oc(=O)ccc12. References: Olguín-Reyes S, et al. Bergamottin is a competitive inhibitor of CYP1A1...
| Schlagworte: | 5-Geranoxypsoralen, Bergamotine, Bergaptin |
| Anwendung: | CYP3A4 inhibitor |
| CAS | 7380-40-7 |
| MW: | 338.4 D |
ab 42,00 €
Bergamottin
Artikelnummer: Cay10009439-1
Bergamottin is a furanocoumarin found in grapefruit juice and lemon, lime, and bergamot oils that has diverse biological activities. In vitro, bergamottin inhibits migration and invasion of HT-1080 fibrosarcoma cells at sub-cytotoxic concentrations via inhibition of matrix metalloproteinase-9 (MMP-9) expression. It...
| Schlagworte: | 5-Geranoxypsoralen, 4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-7H-furo[3,2-g][1]benzopyran-7-one |
| Anwendung: | CYP3A4 inhibitor |
| CAS | 7380-40-7 |
| MW: | 338.4 D |
ab 44,00 €
