Zu "66635-92-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S)-Ketorolac
Artikelnummer: TGM-T12802-2mg
Description: (S)-Ketorolac is a potent inhibitor of COX1 and COX2 enzyme, and is nonsteroidal anti-inflammatory agent. Target: Others. Smiles: OC(=O)[C@H]1CCn2c1ccc2C(=O)c1ccccc1. References: Handley DA, et al. Preclinical enantioselective pharmacology of (R)- and (S)-ketorolac. J Clin Pharmacol. 1998...
| Schlagworte: | (-)-Ketorolac |
| Anwendung: | COX inhibitor |
| CAS | 66635-92-5 |
| MW: | 255.27 D |
74,00 €
(S)-Ketorolac
Artikelnummer: Cay11348-1
(S)-Ketorolac is a non-selective COX inhibitor and non-steroidal anti-inflammatory drug (NSAID, IC50s = 0.1 and 2.7 µM for COX-1 and COX-2, respectively). (S)-Ketorolac is approximately twice as potent as the racemic mixture (Cay-9001148) and 60 times more potent than (R)-ketorolac in a rat pain assay. (S)-Ketorolac...
| Schlagworte: | (-)-Ketorolac, (1S)-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| Anwendung: | COX inhibitor |
| CAS | 66635-92-5 |
| MW: | 255.3 D |
ab 145,00 €
